5-acenaphthylenecarboxylic acid

5-acenaphthylenecarboxylic acid - Names and Identifiers

Name	5-Acenaphthylenecarboxylic acid
Synonyms	5-Acenaphthylenecarboxylic acid 5-acenaphthylenecarboxylic acid Acenaphthylene-5-carboxylic acid
CAS	4488-43-1
InChI	InChI=1/C13H8O2/c14-13(15)11-7-6-9-5-4-8-2-1-3-10(11)12(8)9/h1-7H,(H,14,15)

5-acenaphthylenecarboxylic acid - Physico-chemical Properties

Molecular Formula	C13H8O2
Molar Mass	196.2
Density	1.394
Boling Point	422.311°C at 760 mmHg
Flash Point	186.537°C
Vapor Presure	0mmHg at 25°C
Refractive Index	1.765

5-acenaphthylenecarboxylic acid - Introduction

5-Acenaphthylenecarboxylic acid, also known as 5-Acenaphthylenecarboxylic acid, has the chemical formula C14H10O2. The following is a description of the properties, uses, preparation and safety information of the compound:

Nature:
1. Appearance: 5-Acenaphthylenecarboxylic acid is a white to pale yellow crystalline solid.
2. melting point: about 174-176 ℃.
3. Solubility: Soluble in common organic solvents, such as ethanol, ether and dichloromethane.

Use:
1. 5-Acenaphthylenecarboxylic acid is an important intermediate in organic synthesis, which can be used to synthesize a variety of organic compounds, such as ketones and acids containing 5-acenaphthylenyl.
2. In some medical fields, 5-Acenaphthylenecarboxylic acid is used to synthesize potential bioactive molecules.

Preparation Method:
The preparation of 5-Acenaphthylenecarboxylic acid can usually be carried out by the following steps:
1. First, benzo [a] anthracene (also known as pyrene) can be obtained by thermal cracking, catalytic cracking or oxidation.
2. Then, the obtained benzo [a] anthracene can be reacted with tetramethylphenol through an acid-catalyzed esterification reaction to generate 5-Acenaphthylenecarboxylic acid methyl ester.
3. Finally, 5-Acenaphthylenecarboxylic acid methyl ester can be deprotected to obtain 5-Acenaphthylenecarboxylic acid.

Safety Information:
1.5-Acenaphthylenecarboxylic acid is generally safe under routine laboratory operating conditions, but it is still necessary to pay attention to its proper handling and avoid direct contact with skin and eyes.
2. during operation, good ventilation measures should be taken to avoid inhalation of dust or vapor.
3. When storing and handling the compound, keep away from ignition and oxidizing agents to avoid the risk of fire and explosion.
4. please follow the relevant safety procedures and correct waste disposal methods.

Last Update：2024-04-09 21:01:54